C19H29NO2S2 — CID 134874447
(NE)-N-[cyclohexyl-[(E)-hex-1-enyl]-λ4-sulfanylidene]-4-methylbenzenesulfonamide (PubChem CID 134874447) has the molecular formula C19H29NO2S2 and a molecular weight of 367.58 g/mol. Its IUPAC name is (NE)-N-[cyclohexyl-[(E)-hex-1-enyl]-λ4-sulfanylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NE)-N-[cyclohexyl-[(E)-hex-1-enyl]-λ4-sulfanylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134874447 |
| Molecular Formula | C19H29NO2S2 |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | (NE)-N-[cyclohexyl-[(E)-hex-1-enyl]-λ4-sulfanylidene]-4-methylbenzenesulfonamide |
| SMILES | CCCC/C=C/S(=N/S(=O)(=O)c1ccc(C)cc1)C1CCCCC1 |
| InChI | InChI=1S/C19H29NO2S2/c1-3-4-5-9-16-23(18-10-7-6-8-11-18)20-24(21,22)19-14-12-17(2)13-15-19/h9,12-16,18H,3-8,10-11H2,1-2H3/b16-9+ |
| InChIKey | IFIDLNGFDFERAC-CXUHLZMHSA-N |
| XLogP | 5.52 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|