C11H15NO2S2 — CID 121223017
(NE)-N-[ethenyl(ethyl)-λ4-sulfanylidene]-4-methylbenzenesulfonamide (PubChem CID 121223017) has the molecular formula C11H15NO2S2 and a molecular weight of 257.38 g/mol. Its IUPAC name is (NE)-N-[ethenyl(ethyl)-λ4-sulfanylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NE)-N-[ethenyl(ethyl)-λ4-sulfanylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 121223017 |
| Molecular Formula | C11H15NO2S2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | (NE)-N-[ethenyl(ethyl)-λ4-sulfanylidene]-4-methylbenzenesulfonamide |
| SMILES | C=C/S(CC)=N/S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C11H15NO2S2/c1-4-15(5-2)12-16(13,14)11-8-6-10(3)7-9-11/h4,6-9H,1,5H2,2-3H3 |
| InChIKey | SHJAFXYJHGUSBM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |