C12H15Cl2NO2S2 — CID 46500093
(NE)-N-[(2,2-dichlorocyclopropyl)methyl-methyl-λ4-sulfanylidene]-4-methylbenzenesulfonamide (PubChem CID 46500093) has the molecular formula C12H15Cl2NO2S2 and a molecular weight of 340.30 g/mol. Its IUPAC name is (NE)-N-[(2,2-dichlorocyclopropyl)methyl-methyl-λ4-sulfanylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NE)-N-[(2,2-dichlorocyclopropyl)methyl-methyl-λ4-sulfanylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 46500093 |
| Molecular Formula | C12H15Cl2NO2S2 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | (NE)-N-[(2,2-dichlorocyclopropyl)methyl-methyl-λ4-sulfanylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=S(\C)CC2CC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C12H15Cl2NO2S2/c1-9-3-5-11(6-4-9)19(16,17)15-18(2)8-10-7-12(10,13)14/h3-6,10H,7-8H2,1-2H3 |
| InChIKey | MMMXPPUYGCKETB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|