C11H17NO3S2 — CID 134928927
(NZ)-N-[ethyl(2-hydroxyethyl)-λ4-sulfanylidene]-4-methylbenzenesulfonamide (PubChem CID 134928927) has the molecular formula C11H17NO3S2 and a molecular weight of 275.39 g/mol. Its IUPAC name is (NZ)-N-[ethyl(2-hydroxyethyl)-λ4-sulfanylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NZ)-N-[ethyl(2-hydroxyethyl)-λ4-sulfanylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134928927 |
| Molecular Formula | C11H17NO3S2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | (NZ)-N-[ethyl(2-hydroxyethyl)-λ4-sulfanylidene]-4-methylbenzenesulfonamide |
| SMILES | CC/S(CCO)=N/S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C11H17NO3S2/c1-3-16(9-8-13)12-17(14,15)11-6-4-10(2)5-7-11/h4-7,13H,3,8-9H2,1-2H3 |
| InChIKey | GVSVTAMCVDWQRU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |