C12H18N2O4S — CID 42637465
N,N-bis(2-hydroxyethyl)-N'-(4-methylphenyl)sulfonylmethanimidamide (PubChem CID 42637465) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-N'-(4-methylphenyl)sulfonylmethanimidamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-N'-(4-methylphenyl)sulfonylmethanimidamide |
|---|---|
| PubChem CID | 42637465 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-N'-(4-methylphenyl)sulfonylmethanimidamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C/N(CCO)CCO)cc1 |
| InChI | InChI=1S/C12H18N2O4S/c1-11-2-4-12(5-3-11)19(17,18)13-10-14(6-8-15)7-9-16/h2-5,10,15-16H,6-9H2,1H3/b13-10+ |
| InChIKey | RJFAYXOFIRVCEX-JLHYYAGUSA-N |
| XLogP | -0.00 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|