C16H18ClNO3S2 — CID 153283469
N-[[4-(chloromethyl)phenyl]-ethyl-oxo-λ6-sulfanylidene]-4-methylbenzenesulfonamide (PubChem CID 153283469) has the molecular formula C16H18ClNO3S2 and a molecular weight of 371.91 g/mol. Its IUPAC name is N-[[4-(chloromethyl)phenyl]-ethyl-oxo-λ6-sulfanylidene]-4-methylbenzenesulfonamide.
| Compound Name | N-[[4-(chloromethyl)phenyl]-ethyl-oxo-λ6-sulfanylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 153283469 |
| Molecular Formula | C16H18ClNO3S2 |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | N-[[4-(chloromethyl)phenyl]-ethyl-oxo-λ6-sulfanylidene]-4-methylbenzenesulfonamide |
| SMILES | CCS(=O)(=NS(=O)(=O)c1ccc(C)cc1)c1ccc(CCl)cc1 |
| InChI | InChI=1S/C16H18ClNO3S2/c1-3-22(19,15-10-6-14(12-17)7-11-15)18-23(20,21)16-8-4-13(2)5-9-16/h4-11H,3,12H2,1-2H3 |
| InChIKey | BVQSHFIPPVPQQX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|