About N-[(4-chlorophenyl)-ethyl-oxo-λ6-sulfanylidene]sulfamoyl chloride
N-[(4-chlorophenyl)-ethyl-oxo-λ6-sulfanylidene]sulfamoyl chloride (PubChem CID 125424620) has the molecular formula C8H9Cl2NO3S2
and a molecular weight of 302.20 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-ethyl-oxo-λ6-sulfanylidene]sulfamoyl chloride.
Molecular Properties
| Compound Name | N-[(4-chlorophenyl)-ethyl-oxo-λ6-sulfanylidene]sulfamoyl chloride |
| PubChem CID | 125424620 |
| Molecular Formula | C8H9Cl2NO3S2 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 300.94 |
| IUPAC Name | N-[(4-chlorophenyl)-ethyl-oxo-λ6-sulfanylidene]sulfamoyl chloride |
| SMILES | CC[S@](=O)(=NS(=O)(=O)Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H9Cl2NO3S2/c1-2-15(12,11-16(10,13)14)8-5-3-7(9)4-6-8/h3-6H,2H2,1H3/t15-/m1/s1 |
| InChIKey | IFTZAOHCJMCAPD-OAHLLOKOSA-N |
| XLogP | 2.67 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(4-chlorophenyl)-ethyl-oxo-λ6-sulfanylidene]sulfamoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-chlorophenyl)-ethyl-oxo-λ6-sulfanylidene]sulfamoyl chloride?
The IUPAC name of N-[(4-chlorophenyl)-ethyl-oxo-λ6-sulfanylidene]sulfamoyl chloride (CID 125424620) is N-[(4-chlorophenyl)-ethyl-oxo-λ6-sulfanylidene]sulfamoyl chloride.
What is the SMILES notation for N-[(4-chlorophenyl)-ethyl-oxo-λ6-sulfanylidene]sulfamoyl chloride?
The canonical SMILES for N-[(4-chlorophenyl)-ethyl-oxo-λ6-sulfanylidene]sulfamoyl chloride is CC[S@](=O)(=NS(=O)(=O)Cl)c1ccc(Cl)cc1.
What is the InChIKey of N-[(4-chlorophenyl)-ethyl-oxo-λ6-sulfanylidene]sulfamoyl chloride?
The InChIKey is IFTZAOHCJMCAPD-OAHLLOKOSA-N. The full InChI is InChI=1S/C8H9Cl2NO3S2/c1-2-15(12,11-16(10,13)14)8-5-3-7(9)4-6-8/h3-6H,2H2,1H3/t15-/m1/s1.
What are the key properties of N-[(4-chlorophenyl)-ethyl-oxo-λ6-sulfanylidene]sulfamoyl chloride?
N-[(4-chlorophenyl)-ethyl-oxo-λ6-sulfanylidene]sulfamoyl chloride has a molecular weight of 302.20 g/mol, XLogP of 2.67, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-chlorophenyl)-ethyl-oxo-λ6-sulfanylidene]sulfamoyl chloride is sourced from PubChem (CID 125424620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).