C16H18ClNO2S — CID 43489004
N-[(4-chlorophenyl)-(4-methylsulfonylphenyl)methyl]ethanamine (PubChem CID 43489004) has the molecular formula C16H18ClNO2S and a molecular weight of 323.85 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-(4-methylsulfonylphenyl)methyl]ethanamine.
| Compound Name | N-[(4-chlorophenyl)-(4-methylsulfonylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 43489004 |
| Molecular Formula | C16H18ClNO2S |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | N-[(4-chlorophenyl)-(4-methylsulfonylphenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(Cl)cc1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H18ClNO2S/c1-3-18-16(12-4-8-14(17)9-5-12)13-6-10-15(11-7-13)21(2,19)20/h4-11,16,18H,3H2,1-2H3 |
| InChIKey | HPLXRTNFEXQZQU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |