C20H27NO3S2 — CID 10668295
4-methyl-N-(2-methylhexyl-oxo-phenyl-lambda6-sulfanylidene)benzenesulfonamide (PubChem CID 10668295) has the molecular formula C20H27NO3S2 and a molecular weight of 393.57 g/mol. Its IUPAC name is 4-methyl-N-(2-methylhexyl-oxo-phenyl-lambda6-sulfanylidene)benzenesulfonamide.
| Compound Name | 4-methyl-N-(2-methylhexyl-oxo-phenyl-lambda6-sulfanylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 10668295 |
| Molecular Formula | C20H27NO3S2 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 4-methyl-N-(2-methylhexyl-oxo-phenyl-lambda6-sulfanylidene)benzenesulfonamide |
| SMILES | CCCCC(C)CS(=O)(=NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H27NO3S2/c1-4-5-9-18(3)16-25(22,19-10-7-6-8-11-19)21-26(23,24)20-14-12-17(2)13-15-20/h6-8,10-15,18H,4-5,9,16H2,1-3H3 |
| InChIKey | VZFXVXAPRPXJSG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |