C15H26N2O3Si — CID 24777602
(2S,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-oxo-1-prop-2-enylpyrrolidine-2-carbonitrile (PubChem CID 24777602) has the molecular formula C15H26N2O3Si and a molecular weight of 310.47 g/mol. Its IUPAC name is (2S,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-oxo-1-prop-2-enylpyrrolidine-2-carbonitrile.
| Compound Name | (2S,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-oxo-1-prop-2-enylpyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 24777602 |
| Molecular Formula | C15H26N2O3Si |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (2S,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-oxo-1-prop-2-enylpyrrolidine-2-carbonitrile |
| SMILES | C=CCN1C(=O)[C@H](OC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C#N |
| InChI | InChI=1S/C15H26N2O3Si/c1-8-9-17-11(10-16)12(13(19-5)14(17)18)20-21(6,7)15(2,3)4/h8,11-13H,1,9H2,2-7H3/t11-,12-,13+/m0/s1 |
| InChIKey | TUFPNZFPOAVAMO-RWMBFGLXSA-N |
| XLogP | 2.31 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|