C25H40N2O3Si — CID 11316741
(3R,4S)-4-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-prop-2-enylpiperidin-2-yl]-3-methoxy-1-(4-methylphenyl)azetidin-2-one (PubChem CID 11316741) has the molecular formula C25H40N2O3Si and a molecular weight of 444.69 g/mol. Its IUPAC name is (3R,4S)-4-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-prop-2-enylpiperidin-2-yl]-3-methoxy-1-(4-methylphenyl)azetidin-2-one.
| Compound Name | (3R,4S)-4-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-prop-2-enylpiperidin-2-yl]-3-methoxy-1-(4-methylphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 11316741 |
| Molecular Formula | C25H40N2O3Si |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | (3R,4S)-4-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-prop-2-enylpiperidin-2-yl]-3-methoxy-1-(4-methylphenyl)azetidin-2-one |
| SMILES | C=CCN1CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1[C@H]1[C@@H](OC)C(=O)N1c1ccc(C)cc1 |
| InChI | InChI=1S/C25H40N2O3Si/c1-9-15-26-16-14-20(30-31(7,8)25(3,4)5)17-21(26)22-23(29-6)24(28)27(22)19-12-10-18(2)11-13-19/h9-13,20-23H,1,14-17H2,2-8H3/t20-,21+,22+,23-/m1/s1 |
| InChIKey | SXPLFBVUQNPOST-WZYRSQIMSA-N |
| XLogP | 4.77 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|