C12H23BrO2Si — CID 15109329
cis-(2S,4R)-2-bromo-4-[tert-butyl(dimethyl)silyl]oxycyclohexan-1-one (PubChem CID 15109329) has the molecular formula C12H23BrO2Si and a molecular weight of 307.30 g/mol. Its IUPAC name is cis-(2S,4R)-2-bromo-4-[tert-butyl(dimethyl)silyl]oxycyclohexan-1-one.
| Compound Name | cis-(2S,4R)-2-bromo-4-[tert-butyl(dimethyl)silyl]oxycyclohexan-1-one |
|---|---|
| PubChem CID | 15109329 |
| Molecular Formula | C12H23BrO2Si |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | cis-(2S,4R)-2-bromo-4-[tert-butyl(dimethyl)silyl]oxycyclohexan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCC(=O)[C@@H](Br)C1 |
| InChI | InChI=1S/C12H23BrO2Si/c1-12(2,3)16(4,5)15-9-6-7-11(14)10(13)8-9/h9-10H,6-8H2,1-5H3/t9-,10+/m1/s1 |
| InChIKey | GLFJDUUVSQEYIM-ZJUUUORDSA-N |
| XLogP | 3.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|