C15H28O2Si — CID 57088463
(1S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethylbicyclo[4.1.0]heptan-2-one (PubChem CID 57088463) has the molecular formula C15H28O2Si and a molecular weight of 268.47 g/mol. Its IUPAC name is (1S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethylbicyclo[4.1.0]heptan-2-one.
| Compound Name | (1S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethylbicyclo[4.1.0]heptan-2-one |
|---|---|
| PubChem CID | 57088463 |
| Molecular Formula | C15H28O2Si |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | (1S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethylbicyclo[4.1.0]heptan-2-one |
| SMILES | CC1(C)[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)CCC(=O)[C@@H]21 |
| InChI | InChI=1S/C15H28O2Si/c1-14(2,3)18(6,7)17-11-9-8-10(16)12-13(11)15(12,4)5/h11-13H,8-9H2,1-7H3/t11-,12+,13+/m1/s1 |
| InChIKey | UPDASMMTEHQGJW-AGIUHOORSA-N |
| XLogP | 4.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|