C18H32O2Si — CID 10902926
(4aR,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-4a,5-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one (PubChem CID 10902926) has the molecular formula C18H32O2Si and a molecular weight of 308.54 g/mol. Its IUPAC name is (4aR,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-4a,5-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one.
| Compound Name | (4aR,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-4a,5-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 10902926 |
| Molecular Formula | C18H32O2Si |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | (4aR,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-4a,5-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
| SMILES | C[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C18H32O2Si/c1-13-16(20-21(6,7)17(2,3)4)9-8-14-12-15(19)10-11-18(13,14)5/h12-13,16H,8-11H2,1-7H3/t13-,16-,18+/m0/s1 |
| InChIKey | XHGBCEVSDNWJBC-QANKJYHBSA-N |
| XLogP | 5.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|