C16H26O4Si — CID 123722862
4a,5-dimethyl-6-methylidenesilyloxy-3,4,5,6,7,8-hexahydronaphthalen-2-one;ethyl formate (PubChem CID 123722862) has the molecular formula C16H26O4Si and a molecular weight of 310.47 g/mol. Its IUPAC name is 4a,5-dimethyl-6-methylidenesilyloxy-3,4,5,6,7,8-hexahydronaphthalen-2-one;ethyl formate.
| Compound Name | 4a,5-dimethyl-6-methylidenesilyloxy-3,4,5,6,7,8-hexahydronaphthalen-2-one;ethyl formate |
|---|---|
| PubChem CID | 123722862 |
| Molecular Formula | C16H26O4Si |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 4a,5-dimethyl-6-methylidenesilyloxy-3,4,5,6,7,8-hexahydronaphthalen-2-one;ethyl formate |
| SMILES | C=[SiH]OC1CCC2=CC(=O)CCC2(C)C1C.CCOC=O |
| InChI | InChI=1S/C13H20O2Si.C3H6O2/c1-9-12(15-16-3)5-4-10-8-11(14)6-7-13(9,10)2;1-2-5-3-4/h8-9,12,16H,3-7H2,1-2H3;3H,2H2,1H3 |
| InChIKey | FZIDSUKPUVTQIC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|