About (7a-methyl-5-oxo-2,3,6,7-tetrahydro-1H-inden-1-yl) acetate
(7a-methyl-5-oxo-2,3,6,7-tetrahydro-1H-inden-1-yl) acetate (PubChem CID 13033871) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is (7a-methyl-5-oxo-2,3,6,7-tetrahydro-1H-inden-1-yl) acetate.
Analyze (7a-methyl-5-oxo-2,3,6,7-tetrahydro-1H-inden-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7a-methyl-5-oxo-2,3,6,7-tetrahydro-1H-inden-1-yl) acetate?
The IUPAC name of (7a-methyl-5-oxo-2,3,6,7-tetrahydro-1H-inden-1-yl) acetate (CID 13033871) is (7a-methyl-5-oxo-2,3,6,7-tetrahydro-1H-inden-1-yl) acetate.
What is the SMILES notation for (7a-methyl-5-oxo-2,3,6,7-tetrahydro-1H-inden-1-yl) acetate?
The canonical SMILES for (7a-methyl-5-oxo-2,3,6,7-tetrahydro-1H-inden-1-yl) acetate is CC(=O)OC1CCC2=CC(=O)CCC21C.
What is the InChIKey of (7a-methyl-5-oxo-2,3,6,7-tetrahydro-1H-inden-1-yl) acetate?
The InChIKey is QEUFIBCIDUUJEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-8(13)15-11-4-3-9-7-10(14)5-6-12(9,11)2/h7,11H,3-6H2,1-2H3.
What are the key properties of (7a-methyl-5-oxo-2,3,6,7-tetrahydro-1H-inden-1-yl) acetate?
(7a-methyl-5-oxo-2,3,6,7-tetrahydro-1H-inden-1-yl) acetate has a molecular weight of 208.26 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7a-methyl-5-oxo-2,3,6,7-tetrahydro-1H-inden-1-yl) acetate is sourced from PubChem (CID 13033871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).