C21H30O3 — CID 177436316
[(1S,2R,10S,11E,14R,15S)-2,15-dimethyl-5-oxo-14-tricyclo[8.7.0.02,7]heptadeca-6,11-dienyl] acetate (PubChem CID 177436316) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is [(1S,2R,10S,11E,14R,15S)-2,15-dimethyl-5-oxo-14-tricyclo[8.7.0.02,7]heptadeca-6,11-dienyl] acetate.
| Compound Name | [(1S,2R,10S,11E,14R,15S)-2,15-dimethyl-5-oxo-14-tricyclo[8.7.0.02,7]heptadeca-6,11-dienyl] acetate |
|---|---|
| PubChem CID | 177436316 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | [(1S,2R,10S,11E,14R,15S)-2,15-dimethyl-5-oxo-14-tricyclo[8.7.0.02,7]heptadeca-6,11-dienyl] acetate |
| SMILES | CC(=O)O[C@@H]1C/C=C/[C@@H]2CCC3=CC(=O)CC[C@]3(C)[C@H]2CC[C@@H]1C |
| InChI | InChI=1S/C21H30O3/c1-14-7-10-19-16(5-4-6-20(14)24-15(2)22)8-9-17-13-18(23)11-12-21(17,19)3/h4-5,13-14,16,19-20H,6-12H2,1-3H3/b5-4+/t14-,16+,19-,20+,21-/m0/s1 |
| InChIKey | QNTLBQHREQYVIM-HLIPKCABSA-N |
| XLogP | 4.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|