C19H30O2 — CID 102071483
(1S,2R,10R,14R,15S)-14-hydroxy-2,15-dimethyltricyclo[8.7.0.02,7]heptadec-6-en-5-one (PubChem CID 102071483) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (1S,2R,10R,14R,15S)-14-hydroxy-2,15-dimethyltricyclo[8.7.0.02,7]heptadec-6-en-5-one.
| Compound Name | (1S,2R,10R,14R,15S)-14-hydroxy-2,15-dimethyltricyclo[8.7.0.02,7]heptadec-6-en-5-one |
|---|---|
| PubChem CID | 102071483 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (1S,2R,10R,14R,15S)-14-hydroxy-2,15-dimethyltricyclo[8.7.0.02,7]heptadec-6-en-5-one |
| SMILES | C[C@H]1CC[C@H]2[C@H](CCC[C@H]1O)CCC1=CC(=O)CC[C@@]12C |
| InChI | InChI=1S/C19H30O2/c1-13-6-9-17-14(4-3-5-18(13)21)7-8-15-12-16(20)10-11-19(15,17)2/h12-14,17-18,21H,3-11H2,1-2H3/t13-,14+,17-,18+,19-/m0/s1 |
| InChIKey | GZUPYIUQUYPXAV-ITOHMHRPSA-N |
| XLogP | 4.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |