C21H32O3 — CID 177428448
[(1S,2R,5S,10S,11E,14R,15S)-5-hydroxy-2,15-dimethyl-14-tricyclo[8.7.0.02,7]heptadeca-7,11-dienyl] acetate (PubChem CID 177428448) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is [(1S,2R,5S,10S,11E,14R,15S)-5-hydroxy-2,15-dimethyl-14-tricyclo[8.7.0.02,7]heptadeca-7,11-dienyl] acetate.
| Compound Name | [(1S,2R,5S,10S,11E,14R,15S)-5-hydroxy-2,15-dimethyl-14-tricyclo[8.7.0.02,7]heptadeca-7,11-dienyl] acetate |
|---|---|
| PubChem CID | 177428448 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | [(1S,2R,5S,10S,11E,14R,15S)-5-hydroxy-2,15-dimethyl-14-tricyclo[8.7.0.02,7]heptadeca-7,11-dienyl] acetate |
| SMILES | CC(=O)O[C@@H]1C/C=C/[C@@H]2CC=C3C[C@@H](O)CC[C@]3(C)[C@H]2CC[C@@H]1C |
| InChI | InChI=1S/C21H32O3/c1-14-7-10-19-16(5-4-6-20(14)24-15(2)22)8-9-17-13-18(23)11-12-21(17,19)3/h4-5,9,14,16,18-20,23H,6-8,10-13H2,1-3H3/b5-4+/t14-,16+,18-,19-,20+,21-/m0/s1 |
| InChIKey | XXEJZIDIXCHDQG-BILADUMVSA-N |
| XLogP | 4.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|