C27H46O2Si — CID 91697375
(8S,9S,10R,13S,14S,17S)-17-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 91697375) has the molecular formula C27H46O2Si and a molecular weight of 430.75 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-17-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,17S)-17-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 91697375 |
| Molecular Formula | C27H46O2Si |
| Molecular Weight | 430.75 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-17-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H46O2Si/c1-18(29-30(7,8)25(2,3)4)22-11-12-23-21-10-9-19-17-20(28)13-15-26(19,5)24(21)14-16-27(22,23)6/h17-18,21-24H,9-16H2,1-8H3/t18-,21+,22-,23+,24+,26+,27-/m1/s1 |
| InChIKey | MAZDVFBKVWLQNE-REEZCCHISA-N |
| XLogP | 7.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.75 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|