C21H31FO2 — CID 142402795
[(1S)-1-[(10S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethyl] hypofluorite (PubChem CID 142402795) has the molecular formula C21H31FO2 and a molecular weight of 334.48 g/mol. Its IUPAC name is [(1S)-1-[(10S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethyl] hypofluorite.
| Compound Name | [(1S)-1-[(10S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethyl] hypofluorite |
|---|---|
| PubChem CID | 142402795 |
| Molecular Formula | C21H31FO2 |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | [(1S)-1-[(10S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethyl] hypofluorite |
| SMILES | C[C@H](OF)[C@H]1CCC2C3CCC4=CC(=O)CC[C@@]4(C)C3CCC21C |
| InChI | InChI=1S/C21H31FO2/c1-13(24-22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h12-13,16-19H,4-11H2,1-3H3/t13-,16?,17+,18?,19?,20+,21?/m0/s1 |
| InChIKey | RZDKMBGWVMOQEH-KBZCPIQDSA-N |
| XLogP | 5.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |