C24H39BrO — CID 176946191
17-[(2S)-1-bromopropan-2-yl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one;ethane (PubChem CID 176946191) has the molecular formula C24H39BrO and a molecular weight of 423.48 g/mol. Its IUPAC name is 17-[(2S)-1-bromopropan-2-yl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one;ethane.
| Compound Name | 17-[(2S)-1-bromopropan-2-yl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one;ethane |
|---|---|
| PubChem CID | 176946191 |
| Molecular Formula | C24H39BrO |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 17-[(2S)-1-bromopropan-2-yl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one;ethane |
| SMILES | CC.C[C@H](CBr)C1CCC2C3CCC4=CC(=O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C22H33BrO.C2H6/c1-14(13-23)18-6-7-19-17-5-4-15-12-16(24)8-10-21(15,2)20(17)9-11-22(18,19)3;1-2/h12,14,17-20H,4-11,13H2,1-3H3;1-2H3/t14-,17?,18?,19?,20?,21?,22?;/m1./s1 |
| InChIKey | PZZHXYIMVGGYHB-SBRKFRLYSA-N |
| XLogP | 7.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|