C25H40O2 — CID 56990848
(8S,9R,10R,13R,14S)-17-(6-hydroxyhexan-2-yl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 56990848) has the molecular formula C25H40O2 and a molecular weight of 372.59 g/mol. Its IUPAC name is (8S,9R,10R,13R,14S)-17-(6-hydroxyhexan-2-yl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10R,13R,14S)-17-(6-hydroxyhexan-2-yl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 56990848 |
| Molecular Formula | C25H40O2 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | (8S,9R,10R,13R,14S)-17-(6-hydroxyhexan-2-yl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(CCCCO)C1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C25H40O2/c1-17(6-4-5-15-26)21-9-10-22-20-8-7-18-16-19(27)11-13-24(18,2)23(20)12-14-25(21,22)3/h16-17,20-23,26H,4-15H2,1-3H3/t17?,20-,21?,22-,23+,24-,25+/m0/s1 |
| InChIKey | YIJJZVCPUZMYHM-ZQCWGTNRSA-N |
| XLogP | 5.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|