C18H31BrO2Si — CID 10905169
(4aR,5R,6S,8S)-8-bromo-6-[tert-butyl(dimethyl)silyl]oxy-4a,5-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one (PubChem CID 10905169) has the molecular formula C18H31BrO2Si and a molecular weight of 387.43 g/mol. Its IUPAC name is (4aR,5R,6S,8S)-8-bromo-6-[tert-butyl(dimethyl)silyl]oxy-4a,5-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one.
| Compound Name | (4aR,5R,6S,8S)-8-bromo-6-[tert-butyl(dimethyl)silyl]oxy-4a,5-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 10905169 |
| Molecular Formula | C18H31BrO2Si |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (4aR,5R,6S,8S)-8-bromo-6-[tert-butyl(dimethyl)silyl]oxy-4a,5-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
| SMILES | C[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](Br)C2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C18H31BrO2Si/c1-12-16(21-22(6,7)17(2,3)4)11-15(19)14-10-13(20)8-9-18(12,14)5/h10,12,15-16H,8-9,11H2,1-7H3/t12-,15-,16-,18+/m0/s1 |
| InChIKey | LASRLPRDDQCLNX-VYSRMENRSA-N |
| XLogP | 5.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|