C16H19NO5S — CID 101351558
(3R,5R)-3-methoxy-5-(4-methylphenyl)sulfonyl-1-prop-2-enylpiperidine-2,6-dione (PubChem CID 101351558) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is (3R,5R)-3-methoxy-5-(4-methylphenyl)sulfonyl-1-prop-2-enylpiperidine-2,6-dione.
| Compound Name | (3R,5R)-3-methoxy-5-(4-methylphenyl)sulfonyl-1-prop-2-enylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 101351558 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | (3R,5R)-3-methoxy-5-(4-methylphenyl)sulfonyl-1-prop-2-enylpiperidine-2,6-dione |
| SMILES | C=CCN1C(=O)[C@H](S(=O)(=O)c2ccc(C)cc2)C[C@@H](OC)C1=O |
| InChI | InChI=1S/C16H19NO5S/c1-4-9-17-15(18)13(22-3)10-14(16(17)19)23(20,21)12-7-5-11(2)6-8-12/h4-8,13-14H,1,9-10H2,2-3H3/t13-,14-/m1/s1 |
| InChIKey | JSDWYFKFQVBQJX-ZIAGYGMSSA-N |
| XLogP | 1.10 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|