C21H23NO3S — CID 158026793
6-[(4-methylphenyl)methylsulfonylmethyl]-1-prop-2-enyl-3,4-dihydroquinolin-2-one (PubChem CID 158026793) has the molecular formula C21H23NO3S and a molecular weight of 369.49 g/mol. Its IUPAC name is 6-[(4-methylphenyl)methylsulfonylmethyl]-1-prop-2-enyl-3,4-dihydroquinolin-2-one.
| Compound Name | 6-[(4-methylphenyl)methylsulfonylmethyl]-1-prop-2-enyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 158026793 |
| Molecular Formula | C21H23NO3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 6-[(4-methylphenyl)methylsulfonylmethyl]-1-prop-2-enyl-3,4-dihydroquinolin-2-one |
| SMILES | C=CCN1C(=O)CCc2cc(CS(=O)(=O)Cc3ccc(C)cc3)ccc21 |
| InChI | InChI=1S/C21H23NO3S/c1-3-12-22-20-10-8-18(13-19(20)9-11-21(22)23)15-26(24,25)14-17-6-4-16(2)5-7-17/h3-8,10,13H,1,9,11-12,14-15H2,2H3 |
| InChIKey | ILRZEJOQTIDRGA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|