C20H17F6NO2 — CID 123588520
1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]-6-methyl-3,4-dihydroquinolin-2-one (PubChem CID 123588520) has the molecular formula C20H17F6NO2 and a molecular weight of 417.35 g/mol. Its IUPAC name is 1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]-6-methyl-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]-6-methyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 123588520 |
| Molecular Formula | C20H17F6NO2 |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]-6-methyl-3,4-dihydroquinolin-2-one |
| SMILES | Cc1ccc2c(c1)CCC(=O)N2Cc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H17F6NO2/c1-12-2-8-16-14(10-12)5-9-17(28)27(16)11-13-3-6-15(7-4-13)18(29,19(21,22)23)20(24,25)26/h2-4,6-8,10,29H,5,9,11H2,1H3 |
| InChIKey | LCKSOERCYSELPT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |