C22H19F3N2O3 — CID 31843433
1-[[4-[6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carbonyl]phenyl]methyl]pyrrolidine-2,5-dione (PubChem CID 31843433) has the molecular formula C22H19F3N2O3 and a molecular weight of 416.40 g/mol. Its IUPAC name is 1-[[4-[6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carbonyl]phenyl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[[4-[6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carbonyl]phenyl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 31843433 |
| Molecular Formula | C22H19F3N2O3 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 1-[[4-[6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carbonyl]phenyl]methyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1Cc1ccc(C(=O)N2CCCc3cc(C(F)(F)F)ccc32)cc1 |
| InChI | InChI=1S/C22H19F3N2O3/c23-22(24,25)17-7-8-18-16(12-17)2-1-11-26(18)21(30)15-5-3-14(4-6-15)13-27-19(28)9-10-20(27)29/h3-8,12H,1-2,9-11,13H2 |
| InChIKey | DOAUQISTEDVLTG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|