C21H20N2O4 — CID 167792230
1-[[4-(6-methoxy-2,3-dihydroindole-1-carbonyl)phenyl]methyl]pyrrolidine-2,5-dione (PubChem CID 167792230) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is 1-[[4-(6-methoxy-2,3-dihydroindole-1-carbonyl)phenyl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[[4-(6-methoxy-2,3-dihydroindole-1-carbonyl)phenyl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 167792230 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 1-[[4-(6-methoxy-2,3-dihydroindole-1-carbonyl)phenyl]methyl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc2c(c1)N(C(=O)c1ccc(CN3C(=O)CCC3=O)cc1)CC2 |
| InChI | InChI=1S/C21H20N2O4/c1-27-17-7-6-15-10-11-22(18(15)12-17)21(26)16-4-2-14(3-5-16)13-23-19(24)8-9-20(23)25/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | ZJZZEYRIYDTLOH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|