C25H24N2O4 — CID 26444427
4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylbenzamide (PubChem CID 26444427) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylbenzamide.
| Compound Name | 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 26444427 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylbenzamide |
| SMILES | COc1ccc2cc(CN(C)C(=O)c3ccc(CN4C(=O)CCC4=O)cc3)ccc2c1 |
| InChI | InChI=1S/C25H24N2O4/c1-26(15-18-5-8-21-14-22(31-2)10-9-20(21)13-18)25(30)19-6-3-17(4-7-19)16-27-23(28)11-12-24(27)29/h3-10,13-14H,11-12,15-16H2,1-2H3 |
| InChIKey | FGFKALBNXGARML-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|