C13H15NO5S — CID 2794013
[(5R)-2-oxo-3-prop-2-enyl-1,3-oxazolidin-5-yl] 4-methylbenzenesulfonate (PubChem CID 2794013) has the molecular formula C13H15NO5S and a molecular weight of 297.33 g/mol. Its IUPAC name is [(5R)-2-oxo-3-prop-2-enyl-1,3-oxazolidin-5-yl] 4-methylbenzenesulfonate.
| Compound Name | [(5R)-2-oxo-3-prop-2-enyl-1,3-oxazolidin-5-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 2794013 |
| Molecular Formula | C13H15NO5S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | [(5R)-2-oxo-3-prop-2-enyl-1,3-oxazolidin-5-yl] 4-methylbenzenesulfonate |
| SMILES | C=CCN1C[C@@H](OS(=O)(=O)c2ccc(C)cc2)OC1=O |
| InChI | InChI=1S/C13H15NO5S/c1-3-8-14-9-12(18-13(14)15)19-20(16,17)11-6-4-10(2)5-7-11/h3-7,12H,1,8-9H2,2H3/t12-/m1/s1 |
| InChIKey | VJICWLCWBBVSMK-GFCCVEGCSA-N |
| XLogP | 1.66 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|