C21H31NO5S — CID 2794015
(2-oxo-3-undec-10-enyl-1,3-oxazolidin-5-yl) 4-methylbenzenesulfonate (PubChem CID 2794015) has the molecular formula C21H31NO5S and a molecular weight of 409.55 g/mol. Its IUPAC name is (2-oxo-3-undec-10-enyl-1,3-oxazolidin-5-yl) 4-methylbenzenesulfonate.
| Compound Name | (2-oxo-3-undec-10-enyl-1,3-oxazolidin-5-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 2794015 |
| Molecular Formula | C21H31NO5S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | (2-oxo-3-undec-10-enyl-1,3-oxazolidin-5-yl) 4-methylbenzenesulfonate |
| SMILES | C=CCCCCCCCCCN1CC(OS(=O)(=O)c2ccc(C)cc2)OC1=O |
| InChI | InChI=1S/C21H31NO5S/c1-3-4-5-6-7-8-9-10-11-16-22-17-20(26-21(22)23)27-28(24,25)19-14-12-18(2)13-15-19/h3,12-15,20H,1,4-11,16-17H2,2H3 |
| InChIKey | JXQAWWJSTRUQCK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|