C21H23NO4S — CID 10643814
4-hex-5-enyl-1-(4-methylphenyl)sulfonyl-4H-3,1-benzoxazin-2-one (PubChem CID 10643814) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is 4-hex-5-enyl-1-(4-methylphenyl)sulfonyl-4H-3,1-benzoxazin-2-one.
| Compound Name | 4-hex-5-enyl-1-(4-methylphenyl)sulfonyl-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 10643814 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 4-hex-5-enyl-1-(4-methylphenyl)sulfonyl-4H-3,1-benzoxazin-2-one |
| SMILES | C=CCCCCC1OC(=O)N(S(=O)(=O)c2ccc(C)cc2)c2ccccc21 |
| InChI | InChI=1S/C21H23NO4S/c1-3-4-5-6-11-20-18-9-7-8-10-19(18)22(21(23)26-20)27(24,25)17-14-12-16(2)13-15-17/h3,7-10,12-15,20H,1,4-6,11H2,2H3 |
| InChIKey | OEIMMVKHWMXYEN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|