C21H23NO3S — CID 139125641
(3S,4S)-4-ethenyl-1-(4-methylphenyl)sulfonyl-3-propan-2-yl-3,4-dihydroquinolin-2-one (PubChem CID 139125641) has the molecular formula C21H23NO3S and a molecular weight of 369.49 g/mol. Its IUPAC name is (3S,4S)-4-ethenyl-1-(4-methylphenyl)sulfonyl-3-propan-2-yl-3,4-dihydroquinolin-2-one.
| Compound Name | (3S,4S)-4-ethenyl-1-(4-methylphenyl)sulfonyl-3-propan-2-yl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 139125641 |
| Molecular Formula | C21H23NO3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | (3S,4S)-4-ethenyl-1-(4-methylphenyl)sulfonyl-3-propan-2-yl-3,4-dihydroquinolin-2-one |
| SMILES | C=C[C@@H]1c2ccccc2N(S(=O)(=O)c2ccc(C)cc2)C(=O)[C@H]1C(C)C |
| InChI | InChI=1S/C21H23NO3S/c1-5-17-18-8-6-7-9-19(18)22(21(23)20(17)14(2)3)26(24,25)16-12-10-15(4)11-13-16/h5-14,17,20H,1H2,2-4H3/t17-,20+/m1/s1 |
| InChIKey | ORAFHXIMGRDJIK-XLIONFOSSA-N |
| XLogP | 4.27 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|