C18H19NO3S — CID 15257948
2-ethenyl-3-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonylaziridine (PubChem CID 15257948) has the molecular formula C18H19NO3S and a molecular weight of 329.42 g/mol. Its IUPAC name is 2-ethenyl-3-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonylaziridine.
| Compound Name | 2-ethenyl-3-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonylaziridine |
|---|---|
| PubChem CID | 15257948 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-ethenyl-3-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonylaziridine |
| SMILES | C=CC1C(c2ccccc2OC)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H19NO3S/c1-4-16-18(15-7-5-6-8-17(15)22-3)19(16)23(20,21)14-11-9-13(2)10-12-14/h4-12,16,18H,1H2,2-3H3 |
| InChIKey | NKPBPHZBUVSJNG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|