C23H25NO4S — CID 134954564
(1R,2S,6S)-6-(2,6-dimethoxyphenyl)-2-ethenyl-3-(4-methylphenyl)sulfonyl-3-azabicyclo[4.1.0]hept-4-ene (PubChem CID 134954564) has the molecular formula C23H25NO4S and a molecular weight of 411.52 g/mol. Its IUPAC name is (1R,2S,6S)-6-(2,6-dimethoxyphenyl)-2-ethenyl-3-(4-methylphenyl)sulfonyl-3-azabicyclo[4.1.0]hept-4-ene.
| Compound Name | (1R,2S,6S)-6-(2,6-dimethoxyphenyl)-2-ethenyl-3-(4-methylphenyl)sulfonyl-3-azabicyclo[4.1.0]hept-4-ene |
|---|---|
| PubChem CID | 134954564 |
| Molecular Formula | C23H25NO4S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | (1R,2S,6S)-6-(2,6-dimethoxyphenyl)-2-ethenyl-3-(4-methylphenyl)sulfonyl-3-azabicyclo[4.1.0]hept-4-ene |
| SMILES | C=C[C@H]1[C@@H]2C[C@]2(c2c(OC)cccc2OC)C=CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H25NO4S/c1-5-19-18-15-23(18,22-20(27-3)7-6-8-21(22)28-4)13-14-24(19)29(25,26)17-11-9-16(2)10-12-17/h5-14,18-19H,1,15H2,2-4H3/t18-,19-,23+/m0/s1 |
| InChIKey | WLDWRWHBYNFWMQ-SFYKDHMMSA-N |
| XLogP | 4.04 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|