C20H22N2O3S2 — CID 102332795
(4S,5S)-5-ethenyl-1-(4-methylphenyl)sulfonyl-4-(2-phenylsulfanylethyl)imidazolidin-2-one (PubChem CID 102332795) has the molecular formula C20H22N2O3S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is (4S,5S)-5-ethenyl-1-(4-methylphenyl)sulfonyl-4-(2-phenylsulfanylethyl)imidazolidin-2-one.
| Compound Name | (4S,5S)-5-ethenyl-1-(4-methylphenyl)sulfonyl-4-(2-phenylsulfanylethyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 102332795 |
| Molecular Formula | C20H22N2O3S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (4S,5S)-5-ethenyl-1-(4-methylphenyl)sulfonyl-4-(2-phenylsulfanylethyl)imidazolidin-2-one |
| SMILES | C=C[C@H]1[C@H](CCSc2ccccc2)NC(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H22N2O3S2/c1-3-19-18(13-14-26-16-7-5-4-6-8-16)21-20(23)22(19)27(24,25)17-11-9-15(2)10-12-17/h3-12,18-19H,1,13-14H2,2H3,(H,21,23)/t18-,19-/m0/s1 |
| InChIKey | NADXLTZYYJXXCL-OALUTQOASA-N |
| XLogP | 3.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|