C16H21NO4S — CID 15177624
(4R,5S)-5-tert-butyl-4-ethenyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one (PubChem CID 15177624) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is (4R,5S)-5-tert-butyl-4-ethenyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-5-tert-butyl-4-ethenyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 15177624 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (4R,5S)-5-tert-butyl-4-ethenyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H]1[C@H](C(C)(C)C)OC(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H21NO4S/c1-6-13-14(16(3,4)5)21-15(18)17(13)22(19,20)12-9-7-11(2)8-10-12/h6-10,13-14H,1H2,2-5H3/t13-,14-/m1/s1 |
| InChIKey | RIFPQBQQFUHGOV-ZIAGYGMSSA-N |
| XLogP | 3.11 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|