C26H39NO4SSi — CID 146169071
(4S,6R)-4-ethenyl-3-(4-methylphenyl)sulfonyl-6-[4-tri(propan-2-yl)silylbut-3-ynyl]-1,3-oxazinan-2-one (PubChem CID 146169071) has the molecular formula C26H39NO4SSi and a molecular weight of 489.75 g/mol. Its IUPAC name is (4S,6R)-4-ethenyl-3-(4-methylphenyl)sulfonyl-6-[4-tri(propan-2-yl)silylbut-3-ynyl]-1,3-oxazinan-2-one.
| Compound Name | (4S,6R)-4-ethenyl-3-(4-methylphenyl)sulfonyl-6-[4-tri(propan-2-yl)silylbut-3-ynyl]-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 146169071 |
| Molecular Formula | C26H39NO4SSi |
| Molecular Weight | 489.75 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | (4S,6R)-4-ethenyl-3-(4-methylphenyl)sulfonyl-6-[4-tri(propan-2-yl)silylbut-3-ynyl]-1,3-oxazinan-2-one |
| SMILES | C=C[C@@H]1C[C@@H](CCC#C[Si](C(C)C)(C(C)C)C(C)C)OC(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H39NO4SSi/c1-9-23-18-24(12-10-11-17-33(19(2)3,20(4)5)21(6)7)31-26(28)27(23)32(29,30)25-15-13-22(8)14-16-25/h9,13-16,19-21,23-24H,1,10,12,18H2,2-8H3/t23-,24-/m1/s1 |
| InChIKey | UZBMRCHXXZRLSO-DNQXCXABSA-N |
| XLogP | 6.45 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.75 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|