C15H19NO4S — CID 15177618
(4S,5S)-4-ethenyl-3-(4-methylphenyl)sulfonyl-5-propyl-1,3-oxazolidin-2-one (PubChem CID 15177618) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is (4S,5S)-4-ethenyl-3-(4-methylphenyl)sulfonyl-5-propyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5S)-4-ethenyl-3-(4-methylphenyl)sulfonyl-5-propyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 15177618 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (4S,5S)-4-ethenyl-3-(4-methylphenyl)sulfonyl-5-propyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@H]1[C@H](CCC)OC(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H19NO4S/c1-4-6-14-13(5-2)16(15(17)20-14)21(18,19)12-9-7-11(3)8-10-12/h5,7-10,13-14H,2,4,6H2,1,3H3/t13-,14-/m0/s1 |
| InChIKey | CTZKIQNXENFDIB-KBPBESRZSA-N |
| XLogP | 2.86 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|