C12H14N2O4S — CID 102263590
(3aR,6aR)-3-(4-methylphenyl)sulfonyl-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,3]oxazol-2-one (PubChem CID 102263590) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is (3aR,6aR)-3-(4-methylphenyl)sulfonyl-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,3]oxazol-2-one.
| Compound Name | (3aR,6aR)-3-(4-methylphenyl)sulfonyl-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 102263590 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | (3aR,6aR)-3-(4-methylphenyl)sulfonyl-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,3]oxazol-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)O[C@@H]3CNC[C@H]32)cc1 |
| InChI | InChI=1S/C12H14N2O4S/c1-8-2-4-9(5-3-8)19(16,17)14-10-6-13-7-11(10)18-12(14)15/h2-5,10-11,13H,6-7H2,1H3/t10-,11-/m1/s1 |
| InChIKey | UQJQDOSQRQEQLT-GHMZBOCLSA-N |
| XLogP | 0.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |