C21H20N4O6S — CID 85200528
methyl 2-diazo-2-[2-[3-(4-methylphenyl)sulfonyl-2-oxo-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,3]oxazol-5-yl]phenyl]acetate (PubChem CID 85200528) has the molecular formula C21H20N4O6S and a molecular weight of 456.48 g/mol. Its IUPAC name is methyl 2-diazo-2-[2-[3-(4-methylphenyl)sulfonyl-2-oxo-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,3]oxazol-5-yl]phenyl]acetate.
| Compound Name | methyl 2-diazo-2-[2-[3-(4-methylphenyl)sulfonyl-2-oxo-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,3]oxazol-5-yl]phenyl]acetate |
|---|---|
| PubChem CID | 85200528 |
| Molecular Formula | C21H20N4O6S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | methyl 2-diazo-2-[2-[3-(4-methylphenyl)sulfonyl-2-oxo-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,3]oxazol-5-yl]phenyl]acetate |
| SMILES | COC(=O)C(=[N+]=[N-])c1ccccc1N1CC2OC(=O)N(S(=O)(=O)c3ccc(C)cc3)C2C1 |
| InChI | InChI=1S/C21H20N4O6S/c1-13-7-9-14(10-8-13)32(28,29)25-17-11-24(12-18(17)31-21(25)27)16-6-4-3-5-15(16)19(23-22)20(26)30-2/h3-10,17-18H,11-12H2,1-2H3 |
| InChIKey | HWUNXMGBFKAHLK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 129.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|