C15H17NO4S — CID 101064112
(3aR,8aS)-3-(4-methylphenyl)sulfonyl-6,7,8,8a-tetrahydro-3aH-cyclohepta[d][1,3]oxazol-2-one (PubChem CID 101064112) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is (3aR,8aS)-3-(4-methylphenyl)sulfonyl-6,7,8,8a-tetrahydro-3aH-cyclohepta[d][1,3]oxazol-2-one.
| Compound Name | (3aR,8aS)-3-(4-methylphenyl)sulfonyl-6,7,8,8a-tetrahydro-3aH-cyclohepta[d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 101064112 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | (3aR,8aS)-3-(4-methylphenyl)sulfonyl-6,7,8,8a-tetrahydro-3aH-cyclohepta[d][1,3]oxazol-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)O[C@H]3CCCC=C[C@H]32)cc1 |
| InChI | InChI=1S/C15H17NO4S/c1-11-7-9-12(10-8-11)21(18,19)16-13-5-3-2-4-6-14(13)20-15(16)17/h3,5,7-10,13-14H,2,4,6H2,1H3/t13-,14+/m1/s1 |
| InChIKey | KABKAYHHPDUVSK-KGLIPLIRSA-N |
| XLogP | 2.61 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|