C12H11NO3S — CID 135042515
(1S,4R)-2-(4-methylphenyl)sulfonyl-2-azabicyclo[2.2.0]hex-5-en-3-one (PubChem CID 135042515) has the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. Its IUPAC name is (1S,4R)-2-(4-methylphenyl)sulfonyl-2-azabicyclo[2.2.0]hex-5-en-3-one.
| Compound Name | (1S,4R)-2-(4-methylphenyl)sulfonyl-2-azabicyclo[2.2.0]hex-5-en-3-one |
|---|---|
| PubChem CID | 135042515 |
| Molecular Formula | C12H11NO3S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | (1S,4R)-2-(4-methylphenyl)sulfonyl-2-azabicyclo[2.2.0]hex-5-en-3-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)[C@@H]3C=C[C@@H]32)cc1 |
| InChI | InChI=1S/C12H11NO3S/c1-8-2-4-9(5-3-8)17(15,16)13-11-7-6-10(11)12(13)14/h2-7,10-11H,1H3/t10-,11+/m1/s1 |
| InChIKey | QKOCTHCOPQFRLL-MNOVXSKESA-N |
| XLogP | 1.08 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|