C15H18F3NO3S — CID 75529929
3-tert-butyl-1-(4-methylphenyl)sulfonyl-4-(trifluoromethyl)azetidin-2-one (PubChem CID 75529929) has the molecular formula C15H18F3NO3S and a molecular weight of 349.37 g/mol. Its IUPAC name is 3-tert-butyl-1-(4-methylphenyl)sulfonyl-4-(trifluoromethyl)azetidin-2-one.
| Compound Name | 3-tert-butyl-1-(4-methylphenyl)sulfonyl-4-(trifluoromethyl)azetidin-2-one |
|---|---|
| PubChem CID | 75529929 |
| Molecular Formula | C15H18F3NO3S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 3-tert-butyl-1-(4-methylphenyl)sulfonyl-4-(trifluoromethyl)azetidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)C(C(C)(C)C)C2C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H18F3NO3S/c1-9-5-7-10(8-6-9)23(21,22)19-12(15(16,17)18)11(13(19)20)14(2,3)4/h5-8,11-12H,1-4H3 |
| InChIKey | XHDBFSIINRQWFC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |