C17H16F3NO2S2 — CID 102099212
(2R,3S)-1-(4-methylphenyl)sulfonyl-2-(phenylsulfanylmethyl)-3-(trifluoromethyl)aziridine (PubChem CID 102099212) has the molecular formula C17H16F3NO2S2 and a molecular weight of 387.45 g/mol. Its IUPAC name is (2R,3S)-1-(4-methylphenyl)sulfonyl-2-(phenylsulfanylmethyl)-3-(trifluoromethyl)aziridine.
| Compound Name | (2R,3S)-1-(4-methylphenyl)sulfonyl-2-(phenylsulfanylmethyl)-3-(trifluoromethyl)aziridine |
|---|---|
| PubChem CID | 102099212 |
| Molecular Formula | C17H16F3NO2S2 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | (2R,3S)-1-(4-methylphenyl)sulfonyl-2-(phenylsulfanylmethyl)-3-(trifluoromethyl)aziridine |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H](C(F)(F)F)[C@@H]2CSc2ccccc2)cc1 |
| InChI | InChI=1S/C17H16F3NO2S2/c1-12-7-9-14(10-8-12)25(22,23)21-15(16(21)17(18,19)20)11-24-13-5-3-2-4-6-13/h2-10,15-16H,11H2,1H3/t15-,16-,21?/m0/s1 |
| InChIKey | OMYRFWXFRBASEN-MBFMUOJQSA-N |
| XLogP | 4.09 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|