C23H23NO2SSi — CID 101095697
(1S,5R)-6-(4-methylphenyl)sulfonyl-3,3-diphenyl-6-aza-3-silabicyclo[3.1.0]hexane (PubChem CID 101095697) has the molecular formula C23H23NO2SSi and a molecular weight of 405.60 g/mol. Its IUPAC name is (1S,5R)-6-(4-methylphenyl)sulfonyl-3,3-diphenyl-6-aza-3-silabicyclo[3.1.0]hexane.
| Compound Name | (1S,5R)-6-(4-methylphenyl)sulfonyl-3,3-diphenyl-6-aza-3-silabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 101095697 |
| Molecular Formula | C23H23NO2SSi |
| Molecular Weight | 405.60 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | (1S,5R)-6-(4-methylphenyl)sulfonyl-3,3-diphenyl-6-aza-3-silabicyclo[3.1.0]hexane |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H]3C[Si](c4ccccc4)(c4ccccc4)C[C@@H]32)cc1 |
| InChI | InChI=1S/C23H23NO2SSi/c1-18-12-14-19(15-13-18)27(25,26)24-22-16-28(17-23(22)24,20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-15,22-23H,16-17H2,1H3/t22-,23+,24? |
| InChIKey | GPIHDERJSBQUPX-VSGJHWFKSA-N |
| XLogP | 3.01 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.60 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|