C22H21NO3S — CID 102473250
(2R,4R)-3-(4-methylphenyl)sulfonyl-2,4-diphenyl-1,3-oxazolidine (PubChem CID 102473250) has the molecular formula C22H21NO3S and a molecular weight of 379.48 g/mol. Its IUPAC name is (2R,4R)-3-(4-methylphenyl)sulfonyl-2,4-diphenyl-1,3-oxazolidine.
| Compound Name | (2R,4R)-3-(4-methylphenyl)sulfonyl-2,4-diphenyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 102473250 |
| Molecular Formula | C22H21NO3S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (2R,4R)-3-(4-methylphenyl)sulfonyl-2,4-diphenyl-1,3-oxazolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H](c3ccccc3)OC[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21NO3S/c1-17-12-14-20(15-13-17)27(24,25)23-21(18-8-4-2-5-9-18)16-26-22(23)19-10-6-3-7-11-19/h2-15,21-22H,16H2,1H3/t21-,22+/m0/s1 |
| InChIKey | DSRVVJUEAVGILA-FCHUYYIVSA-N |
| XLogP | 4.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |