C15H11F6NO2S — CID 134869418
7-(4-methylphenyl)sulfonyl-2,3-bis(trifluoromethyl)-7-azabicyclo[2.2.1]hepta-2,5-diene (PubChem CID 134869418) has the molecular formula C15H11F6NO2S and a molecular weight of 383.31 g/mol. Its IUPAC name is 7-(4-methylphenyl)sulfonyl-2,3-bis(trifluoromethyl)-7-azabicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | 7-(4-methylphenyl)sulfonyl-2,3-bis(trifluoromethyl)-7-azabicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 134869418 |
| Molecular Formula | C15H11F6NO2S |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 7-(4-methylphenyl)sulfonyl-2,3-bis(trifluoromethyl)-7-azabicyclo[2.2.1]hepta-2,5-diene |
| SMILES | Cc1ccc(S(=O)(=O)N2C3C=CC2C(C(F)(F)F)=C3C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H11F6NO2S/c1-8-2-4-9(5-3-8)25(23,24)22-10-6-7-11(22)13(15(19,20)21)12(10)14(16,17)18/h2-7,10-11H,1H3 |
| InChIKey | OLBFINMUWIHWEU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|