C12H14F3NO2S — CID 155605857
1-(4-methylphenyl)sulfonyl-2-(1,1,1-trifluoropropan-2-yl)aziridine (PubChem CID 155605857) has the molecular formula C12H14F3NO2S and a molecular weight of 293.31 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-2-(1,1,1-trifluoropropan-2-yl)aziridine.
| Compound Name | 1-(4-methylphenyl)sulfonyl-2-(1,1,1-trifluoropropan-2-yl)aziridine |
|---|---|
| PubChem CID | 155605857 |
| Molecular Formula | C12H14F3NO2S |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-2-(1,1,1-trifluoropropan-2-yl)aziridine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC2C(C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H14F3NO2S/c1-8-3-5-10(6-4-8)19(17,18)16-7-11(16)9(2)12(13,14)15/h3-6,9,11H,7H2,1-2H3 |
| InChIKey | JFCFNRCGUXEERQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|